C16H23ClN3O2+ — CID 9306248
[(1S)-1-(2-chlorophenyl)ethyl]-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]azanium (PubChem CID 9306248) has the molecular formula C16H23ClN3O2+ and a molecular weight of 324.83 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl]-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9306248 |
| Molecular Formula | C16H23ClN3O2+ |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NC(=O)NC1CCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C16H22ClN3O2/c1-11(13-8-4-5-9-14(13)17)18-10-15(21)20-16(22)19-12-6-2-3-7-12/h4-5,8-9,11-12,18H,2-3,6-7,10H2,1H3,(H2,19,20,21,22)/p+1/t11-/m0/s1 |
| InChIKey | RUOAKYXFEZHQCC-NSHDSACASA-O |
| XLogP | 1.73 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |