C15H24N3O3+ — CID 8919610
[2-(cyclohexylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8919610) has the molecular formula C15H24N3O3+ and a molecular weight of 294.37 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8919610 |
| Molecular Formula | C15H24N3O3+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)NC(=O)NC1CCCCC1)c1ccco1 |
| InChI | InChI=1S/C15H23N3O3/c1-11(13-8-5-9-21-13)16-10-14(19)18-15(20)17-12-6-3-2-4-7-12/h5,8-9,11-12,16H,2-4,6-7,10H2,1H3,(H2,17,18,19,20)/p+1/t11-/m1/s1 |
| InChIKey | GGAIBNIWBNNKJT-LLVKDONJSA-O |
| XLogP | 1.06 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |