C20H26N3O3+ — CID 8755215
[2-(cyclohexylcarbamoylamino)-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8755215) has the molecular formula C20H26N3O3+ and a molecular weight of 356.45 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8755215 |
| Molecular Formula | C20H26N3O3+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@@H](c1ccccc1)c1ccco1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H25N3O3/c24-18(23-20(25)22-16-10-5-2-6-11-16)14-21-19(17-12-7-13-26-17)15-8-3-1-4-9-15/h1,3-4,7-9,12-13,16,19,21H,2,5-6,10-11,14H2,(H2,22,23,24,25)/p+1/t19-/m0/s1 |
| InChIKey | PYCGZNWHBQNBLL-IBGZPJMESA-O |
| XLogP | 2.09 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |