C18H25N2O2+ — CID 8755033
[(S)-furan-2-yl(phenyl)methyl]-[2-(3-methylbutylamino)-2-oxoethyl]azanium (PubChem CID 8755033) has the molecular formula C18H25N2O2+ and a molecular weight of 301.41 g/mol. Its IUPAC name is [(S)-furan-2-yl(phenyl)methyl]-[2-(3-methylbutylamino)-2-oxoethyl]azanium.
| Compound Name | [(S)-furan-2-yl(phenyl)methyl]-[2-(3-methylbutylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8755033 |
| Molecular Formula | C18H25N2O2+ |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | [(S)-furan-2-yl(phenyl)methyl]-[2-(3-methylbutylamino)-2-oxoethyl]azanium |
| SMILES | CC(C)CCNC(=O)C[NH2+][C@@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C18H24N2O2/c1-14(2)10-11-19-17(21)13-20-18(16-9-6-12-22-16)15-7-4-3-5-8-15/h3-9,12,14,18,20H,10-11,13H2,1-2H3,(H,19,21)/p+1/t18-/m0/s1 |
| InChIKey | KDZFSYIHAZFVSD-SFHVURJKSA-O |
| XLogP | 2.09 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |