C19H21N2O2S+ — CID 8756017
[(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl]azanium (PubChem CID 8756017) has the molecular formula C19H21N2O2S+ and a molecular weight of 341.46 g/mol. Its IUPAC name is [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl]azanium.
| Compound Name | [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8756017 |
| Molecular Formula | C19H21N2O2S+ |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl]azanium |
| SMILES | C[C@@H](NC(=O)C[NH2+][C@H](c1ccccc1)c1ccco1)c1cccs1 |
| InChI | InChI=1S/C19H20N2O2S/c1-14(17-10-6-12-24-17)21-18(22)13-20-19(16-9-5-11-23-16)15-7-3-2-4-8-15/h2-12,14,19-20H,13H2,1H3,(H,21,22)/p+1/t14-,19-/m1/s1 |
| InChIKey | AAUWJCHYLCHNGK-AUUYWEPGSA-O |
| XLogP | 2.87 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |