C25H33N2O2+ — CID 8755061
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8755061) has the molecular formula C25H33N2O2+ and a molecular weight of 393.55 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8755061 |
| Molecular Formula | C25H33N2O2+ |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | C[C@@H](NC(=O)C[NH2+][C@@H](c1ccccc1)c1ccco1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H32N2O2/c1-17(25-13-18-10-19(14-25)12-20(11-18)15-25)27-23(28)16-26-24(22-8-5-9-29-22)21-6-3-2-4-7-21/h2-9,17-20,24,26H,10-16H2,1H3,(H,27,28)/p+1/t17-,18?,19?,20?,24+,25?/m1/s1 |
| InChIKey | ZNFRURAHAIWGRV-XAXRTNJYSA-O |
| XLogP | 3.65 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |