C17H30N3O2+ — CID 8771959
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium (PubChem CID 8771959) has the molecular formula C17H30N3O2+ and a molecular weight of 308.45 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8771959 |
| Molecular Formula | C17H30N3O2+ |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)C[NH2+]CC(=O)N[C@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H29N3O2/c1-11(20-16(22)10-19-9-15(21)18-2)17-6-12-3-13(7-17)5-14(4-12)8-17/h11-14,19H,3-10H2,1-2H3,(H,18,21)(H,20,22)/p+1/t11-,12?,13?,14?,17?/m1/s1 |
| InChIKey | HVMWJFCGMCXFDC-SFCYXTAJSA-O |
| XLogP | 0.02 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |