C25H31N2O+ — CID 7971177
[2-(1-adamantylamino)-2-oxoethyl]-benzhydrylazanium (PubChem CID 7971177) has the molecular formula C25H31N2O+ and a molecular weight of 375.54 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl]-benzhydrylazanium.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl]-benzhydrylazanium |
|---|---|
| PubChem CID | 7971177 |
| Molecular Formula | C25H31N2O+ |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl]-benzhydrylazanium |
| SMILES | O=C(C[NH2+]C(c1ccccc1)c1ccccc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H30N2O/c28-23(27-25-14-18-11-19(15-25)13-20(12-18)16-25)17-26-24(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-10,18-20,24,26H,11-17H2,(H,27,28)/p+1 |
| InChIKey | NSMIJMBFBMRFPO-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |