C23H30N2O4 — CID 8753901
[2-(1-adamantylcarbamoylamino)-2-oxoethyl] (2R)-2-phenylbutanoate (PubChem CID 8753901) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is [2-(1-adamantylcarbamoylamino)-2-oxoethyl] (2R)-2-phenylbutanoate.
| Compound Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] (2R)-2-phenylbutanoate |
|---|---|
| PubChem CID | 8753901 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)OCC(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O4/c1-2-19(18-6-4-3-5-7-18)21(27)29-14-20(26)24-22(28)25-23-11-15-8-16(12-23)10-17(9-15)13-23/h3-7,15-17,19H,2,8-14H2,1H3,(H2,24,25,26,28)/t15?,16?,17?,19-,23?/m1/s1 |
| InChIKey | BVPCCZWWNUWVQI-YLSHDAJPSA-N |
| XLogP | 3.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |