About 1-adamantyl 2-phenylbutanoate
1-adamantyl 2-phenylbutanoate (PubChem CID 101257147) has the molecular formula C20H26O2
and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-adamantyl 2-phenylbutanoate.
Molecular Properties
| Compound Name | 1-adamantyl 2-phenylbutanoate |
| PubChem CID | 101257147 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-adamantyl 2-phenylbutanoate |
| SMILES | CCC(C(=O)OC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C20H26O2/c1-2-18(17-6-4-3-5-7-17)19(21)22-20-11-14-8-15(12-20)10-16(9-14)13-20/h3-7,14-16,18H,2,8-13H2,1H3 |
| InChIKey | HFGRTNKJYAFIRV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantyl 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl 2-phenylbutanoate?
The IUPAC name of 1-adamantyl 2-phenylbutanoate (CID 101257147) is 1-adamantyl 2-phenylbutanoate.
What is the SMILES notation for 1-adamantyl 2-phenylbutanoate?
The canonical SMILES for 1-adamantyl 2-phenylbutanoate is CCC(C(=O)OC12CC3CC(CC(C3)C1)C2)c1ccccc1.
What is the InChIKey of 1-adamantyl 2-phenylbutanoate?
The InChIKey is HFGRTNKJYAFIRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O2/c1-2-18(17-6-4-3-5-7-17)19(21)22-20-11-14-8-15(12-20)10-16(9-14)13-20/h3-7,14-16,18H,2,8-13H2,1H3.
What are the key properties of 1-adamantyl 2-phenylbutanoate?
1-adamantyl 2-phenylbutanoate has a molecular weight of 298.43 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl 2-phenylbutanoate is sourced from PubChem (CID 101257147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).