C17H23NO2 — CID 161187729
[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylbutanoate (PubChem CID 161187729) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylbutanoate.
| Compound Name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 161187729 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)OC1C[C@H]2CC[C@@H](C1)N2)c1ccccc1 |
| InChI | InChI=1S/C17H23NO2/c1-2-16(12-6-4-3-5-7-12)17(19)20-15-10-13-8-9-14(11-15)18-13/h3-7,13-16,18H,2,8-11H2,1H3/t13-,14+,15?,16? |
| InChIKey | PGTPRMPZBUNQTD-PJPHBNEVSA-N |
| XLogP | 3.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |