C17H26ClNO7S — CID 70532334
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate;sulfuric acid;hydrochloride (PubChem CID 70532334) has the molecular formula C17H26ClNO7S and a molecular weight of 423.92 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate;sulfuric acid;hydrochloride.
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate;sulfuric acid;hydrochloride |
|---|---|
| PubChem CID | 70532334 |
| Molecular Formula | C17H26ClNO7S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate;sulfuric acid;hydrochloride |
| SMILES | CN1C2CCC1CC(OC(=O)C(CO)c1ccccc1)C2.Cl.O=S(=O)(O)O |
| InChI | InChI=1S/C17H23NO3.ClH.H2O4S/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12;;1-5(2,3)4/h2-6,13-16,19H,7-11H2,1H3;1H;(H2,1,2,3,4) |
| InChIKey | ZNLUZKOIOBDDCJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|