C17H25NO6S — CID 67047641
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfurous acid (PubChem CID 67047641) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfurous acid.
| Compound Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfurous acid |
|---|---|
| PubChem CID | 67047641 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfurous acid |
| SMILES | CN1[C@@H]2CC[C@H]1CC(OC(=O)C(CO)c1ccccc1)C2.O=S(O)O |
| InChI | InChI=1S/C17H23NO3.H2O3S/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12;1-4(2)3/h2-6,13-16,19H,7-11H2,1H3;(H2,1,2,3)/t13-,14+,15?,16?; |
| InChIKey | NCONHCMSBTUKSM-ZZJGABIISA-N |
| XLogP | 1.61 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|