About ethenyl 2-phenylbutanoate
ethenyl 2-phenylbutanoate (PubChem CID 10932238) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is ethenyl 2-phenylbutanoate.
Molecular Properties
| Compound Name | ethenyl 2-phenylbutanoate |
| PubChem CID | 10932238 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | ethenyl 2-phenylbutanoate |
| SMILES | C=COC(=O)C(CC)c1ccccc1 |
| InChI | InChI=1S/C12H14O2/c1-3-11(12(13)14-4-2)10-8-6-5-7-9-10/h4-9,11H,2-3H2,1H3 |
| InChIKey | DEKMOEUIDLNJII-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 2-phenylbutanoate?
The IUPAC name of ethenyl 2-phenylbutanoate (CID 10932238) is ethenyl 2-phenylbutanoate.
What is the SMILES notation for ethenyl 2-phenylbutanoate?
The canonical SMILES for ethenyl 2-phenylbutanoate is C=COC(=O)C(CC)c1ccccc1.
What is the InChIKey of ethenyl 2-phenylbutanoate?
The InChIKey is DEKMOEUIDLNJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-3-11(12(13)14-4-2)10-8-6-5-7-9-10/h4-9,11H,2-3H2,1H3.
What are the key properties of ethenyl 2-phenylbutanoate?
ethenyl 2-phenylbutanoate has a molecular weight of 190.24 g/mol, XLogP of 2.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 2-phenylbutanoate is sourced from PubChem (CID 10932238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).