About (2R)-2-phenylbutanamide
(2R)-2-phenylbutanamide (PubChem CID 139147476) has the molecular formula C20H26N2O2
and a molecular weight of 326.44 g/mol. Its IUPAC name is (2R)-2-phenylbutanamide.
Molecular Properties
| Compound Name | (2R)-2-phenylbutanamide |
| PubChem CID | 139147476 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2R)-2-phenylbutanamide |
| SMILES | CCC(C(N)=O)c1ccccc1.CC[C@@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/2C10H13NO/c2*1-2-9(10(11)12)8-6-4-3-5-7-8/h2*3-7,9H,2H2,1H3,(H2,11,12)/t9-;/m1./s1 |
| InChIKey | HVXIZSACXZSFEP-SBSPUUFOSA-N |
| XLogP | 3.33 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-phenylbutanamide?
The IUPAC name of (2R)-2-phenylbutanamide (CID 139147476) is (2R)-2-phenylbutanamide.
What is the SMILES notation for (2R)-2-phenylbutanamide?
The canonical SMILES for (2R)-2-phenylbutanamide is CCC(C(N)=O)c1ccccc1.CC[C@@H](C(N)=O)c1ccccc1.
What is the InChIKey of (2R)-2-phenylbutanamide?
The InChIKey is HVXIZSACXZSFEP-SBSPUUFOSA-N. The full InChI is InChI=1S/2C10H13NO/c2*1-2-9(10(11)12)8-6-4-3-5-7-8/h2*3-7,9H,2H2,1H3,(H2,11,12)/t9-;/m1./s1.
What are the key properties of (2R)-2-phenylbutanamide?
(2R)-2-phenylbutanamide has a molecular weight of 326.44 g/mol, XLogP of 3.33, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-phenylbutanamide is sourced from PubChem (CID 139147476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).