About 2-pyridin-4-ylbutanamide
2-pyridin-4-ylbutanamide (PubChem CID 67405148) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-pyridin-4-ylbutanamide.
Molecular Properties
| Compound Name | 2-pyridin-4-ylbutanamide |
| PubChem CID | 67405148 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-pyridin-4-ylbutanamide |
| SMILES | CCC(C(N)=O)c1ccncc1 |
| InChI | InChI=1S/C9H12N2O/c1-2-8(9(10)12)7-3-5-11-6-4-7/h3-6,8H,2H2,1H3,(H2,10,12) |
| InChIKey | GHXROAQHBHYDJK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-4-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-ylbutanamide?
The IUPAC name of 2-pyridin-4-ylbutanamide (CID 67405148) is 2-pyridin-4-ylbutanamide.
What is the SMILES notation for 2-pyridin-4-ylbutanamide?
The canonical SMILES for 2-pyridin-4-ylbutanamide is CCC(C(N)=O)c1ccncc1.
What is the InChIKey of 2-pyridin-4-ylbutanamide?
The InChIKey is GHXROAQHBHYDJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-2-8(9(10)12)7-3-5-11-6-4-7/h3-6,8H,2H2,1H3,(H2,10,12).
What are the key properties of 2-pyridin-4-ylbutanamide?
2-pyridin-4-ylbutanamide has a molecular weight of 164.21 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-ylbutanamide is sourced from PubChem (CID 67405148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).