C13H19NO — CID 102483354
5,5-dimethyl-3-pyridin-4-ylhexan-2-one (PubChem CID 102483354) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 5,5-dimethyl-3-pyridin-4-ylhexan-2-one.
| Compound Name | 5,5-dimethyl-3-pyridin-4-ylhexan-2-one |
|---|---|
| PubChem CID | 102483354 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 5,5-dimethyl-3-pyridin-4-ylhexan-2-one |
| SMILES | CC(=O)C(CC(C)(C)C)c1ccncc1 |
| InChI | InChI=1S/C13H19NO/c1-10(15)12(9-13(2,3)4)11-5-7-14-8-6-11/h5-8,12H,9H2,1-4H3 |
| InChIKey | ZQCOWEPSOSNJAC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |