C16H14FNO2 — CID 59932568
1-(4-fluorophenyl)-2-pyridin-4-ylpentane-1,4-dione (PubChem CID 59932568) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-pyridin-4-ylpentane-1,4-dione.
| Compound Name | 1-(4-fluorophenyl)-2-pyridin-4-ylpentane-1,4-dione |
|---|---|
| PubChem CID | 59932568 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(4-fluorophenyl)-2-pyridin-4-ylpentane-1,4-dione |
| SMILES | CC(=O)CC(C(=O)c1ccc(F)cc1)c1ccncc1 |
| InChI | InChI=1S/C16H14FNO2/c1-11(19)10-15(12-6-8-18-9-7-12)16(20)13-2-4-14(17)5-3-13/h2-9,15H,10H2,1H3 |
| InChIKey | ITAGDDQYLFQVFG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |