C21H16ClNO2 — CID 18939015
1-(4-chlorophenyl)-4-phenyl-2-pyridin-4-ylbutane-1,4-dione (PubChem CID 18939015) has the molecular formula C21H16ClNO2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-phenyl-2-pyridin-4-ylbutane-1,4-dione.
| Compound Name | 1-(4-chlorophenyl)-4-phenyl-2-pyridin-4-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 18939015 |
| Molecular Formula | C21H16ClNO2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(4-chlorophenyl)-4-phenyl-2-pyridin-4-ylbutane-1,4-dione |
| SMILES | O=C(CC(C(=O)c1ccc(Cl)cc1)c1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C21H16ClNO2/c22-18-8-6-17(7-9-18)21(25)19(15-10-12-23-13-11-15)14-20(24)16-4-2-1-3-5-16/h1-13,19H,14H2 |
| InChIKey | JPROHXNITPSECY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |