C22H17ClO2 — CID 135053959
(2R)-1-(4-chlorophenyl)-2,4-diphenylbutane-1,4-dione (PubChem CID 135053959) has the molecular formula C22H17ClO2 and a molecular weight of 348.83 g/mol. Its IUPAC name is (2R)-1-(4-chlorophenyl)-2,4-diphenylbutane-1,4-dione.
| Compound Name | (2R)-1-(4-chlorophenyl)-2,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 135053959 |
| Molecular Formula | C22H17ClO2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2R)-1-(4-chlorophenyl)-2,4-diphenylbutane-1,4-dione |
| SMILES | O=C(C[C@@H](C(=O)c1ccc(Cl)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17ClO2/c23-19-13-11-18(12-14-19)22(25)20(16-7-3-1-4-8-16)15-21(24)17-9-5-2-6-10-17/h1-14,20H,15H2/t20-/m1/s1 |
| InChIKey | JQOBVOUZOIZEHQ-HXUWFJFHSA-N |
| XLogP | 5.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |