C23H17ClO3 — CID 11839356
1-(4-chlorophenyl)-2,5-diphenylpentane-1,3,5-trione (PubChem CID 11839356) has the molecular formula C23H17ClO3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,5-diphenylpentane-1,3,5-trione.
| Compound Name | 1-(4-chlorophenyl)-2,5-diphenylpentane-1,3,5-trione |
|---|---|
| PubChem CID | 11839356 |
| Molecular Formula | C23H17ClO3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-(4-chlorophenyl)-2,5-diphenylpentane-1,3,5-trione |
| SMILES | O=C(CC(=O)C(C(=O)c1ccc(Cl)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17ClO3/c24-19-13-11-18(12-14-19)23(27)22(17-9-5-2-6-10-17)21(26)15-20(25)16-7-3-1-4-8-16/h1-14,22H,15H2 |
| InChIKey | FSQWXBNXGNTTNK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|