C18H15ClO5 — CID 67292277
2-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]propanedioic acid (PubChem CID 67292277) has the molecular formula C18H15ClO5 and a molecular weight of 346.77 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]propanedioic acid.
| Compound Name | 2-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]propanedioic acid |
|---|---|
| PubChem CID | 67292277 |
| Molecular Formula | C18H15ClO5 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]propanedioic acid |
| SMILES | O=C(CC(c1ccc(Cl)cc1)C(C(=O)O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H15ClO5/c19-13-8-6-11(7-9-13)14(16(17(21)22)18(23)24)10-15(20)12-4-2-1-3-5-12/h1-9,14,16H,10H2,(H,21,22)(H,23,24) |
| InChIKey | ZSEUDXKRAOIMJQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|