C17H14O4 — CID 54247334
3,5-dioxo-2,5-diphenylpentanoic acid (PubChem CID 54247334) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3,5-dioxo-2,5-diphenylpentanoic acid.
| Compound Name | 3,5-dioxo-2,5-diphenylpentanoic acid |
|---|---|
| PubChem CID | 54247334 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3,5-dioxo-2,5-diphenylpentanoic acid |
| SMILES | O=C(CC(=O)C(C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14O4/c18-14(12-7-3-1-4-8-12)11-15(19)16(17(20)21)13-9-5-2-6-10-13/h1-10,16H,11H2,(H,20,21) |
| InChIKey | QUESOBUHCHANQN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|