C18H16O3 — CID 14303545
2-methyl-1,5-diphenylpentane-1,3,5-trione (PubChem CID 14303545) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-methyl-1,5-diphenylpentane-1,3,5-trione.
| Compound Name | 2-methyl-1,5-diphenylpentane-1,3,5-trione |
|---|---|
| PubChem CID | 14303545 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-methyl-1,5-diphenylpentane-1,3,5-trione |
| SMILES | CC(C(=O)CC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16O3/c1-13(18(21)15-10-6-3-7-11-15)16(19)12-17(20)14-8-4-2-5-9-14/h2-11,13H,12H2,1H3 |
| InChIKey | HFKJINVFBJLTCK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|