C18H15ClO3 — CID 19847705
1-(2-chlorophenyl)-2-methyl-5-phenylpentane-1,3,5-trione (PubChem CID 19847705) has the molecular formula C18H15ClO3 and a molecular weight of 314.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-methyl-5-phenylpentane-1,3,5-trione.
| Compound Name | 1-(2-chlorophenyl)-2-methyl-5-phenylpentane-1,3,5-trione |
|---|---|
| PubChem CID | 19847705 |
| Molecular Formula | C18H15ClO3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-(2-chlorophenyl)-2-methyl-5-phenylpentane-1,3,5-trione |
| SMILES | CC(C(=O)CC(=O)c1ccccc1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H15ClO3/c1-12(18(22)14-9-5-6-10-15(14)19)16(20)11-17(21)13-7-3-2-4-8-13/h2-10,12H,11H2,1H3 |
| InChIKey | SIOMSBRFGFVOTO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|