C19H18O4 — CID 19847704
1-(4-methoxyphenyl)-2-methyl-5-phenylpentane-1,3,5-trione (PubChem CID 19847704) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-methyl-5-phenylpentane-1,3,5-trione.
| Compound Name | 1-(4-methoxyphenyl)-2-methyl-5-phenylpentane-1,3,5-trione |
|---|---|
| PubChem CID | 19847704 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-methyl-5-phenylpentane-1,3,5-trione |
| SMILES | COc1ccc(C(=O)C(C)C(=O)CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18O4/c1-13(19(22)15-8-10-16(23-2)11-9-15)17(20)12-18(21)14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3 |
| InChIKey | QKAGBOCFQOFCSY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|