C12H13FO2 — CID 64720461
1-(4-fluorophenyl)-2-methylpentane-1,4-dione (PubChem CID 64720461) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-methylpentane-1,4-dione.
| Compound Name | 1-(4-fluorophenyl)-2-methylpentane-1,4-dione |
|---|---|
| PubChem CID | 64720461 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1-(4-fluorophenyl)-2-methylpentane-1,4-dione |
| SMILES | CC(=O)CC(C)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FO2/c1-8(7-9(2)14)12(15)10-3-5-11(13)6-4-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | WZBBVJMPFFZLET-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |