C18H18F2N2O2 — CID 141384133
2,2-diamino-3-ethyl-1,4-bis(4-fluorophenyl)butane-1,4-dione (PubChem CID 141384133) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2,2-diamino-3-ethyl-1,4-bis(4-fluorophenyl)butane-1,4-dione.
| Compound Name | 2,2-diamino-3-ethyl-1,4-bis(4-fluorophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 141384133 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2,2-diamino-3-ethyl-1,4-bis(4-fluorophenyl)butane-1,4-dione |
| SMILES | CCC(C(=O)c1ccc(F)cc1)C(N)(N)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18F2N2O2/c1-2-15(16(23)11-3-7-13(19)8-4-11)18(21,22)17(24)12-5-9-14(20)10-6-12/h3-10,15H,2,21-22H2,1H3 |
| InChIKey | AATYCUNKTYTMAC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|