C11H11FO5 — CID 171482605
ethyl 3-(4-fluorophenyl)-2,2-dihydroxy-3-oxopropanoate (PubChem CID 171482605) has the molecular formula C11H11FO5 and a molecular weight of 242.20 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-2,2-dihydroxy-3-oxopropanoate.
| Compound Name | ethyl 3-(4-fluorophenyl)-2,2-dihydroxy-3-oxopropanoate |
|---|---|
| PubChem CID | 171482605 |
| Molecular Formula | C11H11FO5 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-2,2-dihydroxy-3-oxopropanoate |
| SMILES | CCOC(=O)C(O)(O)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FO5/c1-2-17-10(14)11(15,16)9(13)7-3-5-8(12)6-4-7/h3-6,15-16H,2H2,1H3 |
| InChIKey | DQVPCPOQBUUSJS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|