C24H26F2O7 — CID 161489797
ethyl 2-(4-fluorophenyl)-2-hydroxy-4-oxohexanoate;ethyl 2-(4-fluorophenyl)-2-oxoacetate (PubChem CID 161489797) has the molecular formula C24H26F2O7 and a molecular weight of 464.46 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)-2-hydroxy-4-oxohexanoate;ethyl 2-(4-fluorophenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(4-fluorophenyl)-2-hydroxy-4-oxohexanoate;ethyl 2-(4-fluorophenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 161489797 |
| Molecular Formula | C24H26F2O7 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | ethyl 2-(4-fluorophenyl)-2-hydroxy-4-oxohexanoate;ethyl 2-(4-fluorophenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1ccc(F)cc1.CCOC(=O)C(O)(CC(=O)CC)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FO4.C10H9FO3/c1-3-12(16)9-14(18,13(17)19-4-2)10-5-7-11(15)8-6-10;1-2-14-10(13)9(12)7-3-5-8(11)6-4-7/h5-8,18H,3-4,9H2,1-2H3;3-6H,2H2,1H3 |
| InChIKey | WFLMXLMITSHXKY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|