C23H22FO4P — CID 132569334
ethyl 3-diphenylphosphoryl-2-(4-fluorophenyl)-2-hydroxypropanoate (PubChem CID 132569334) has the molecular formula C23H22FO4P and a molecular weight of 412.40 g/mol. Its IUPAC name is ethyl 3-diphenylphosphoryl-2-(4-fluorophenyl)-2-hydroxypropanoate.
| Compound Name | ethyl 3-diphenylphosphoryl-2-(4-fluorophenyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 132569334 |
| Molecular Formula | C23H22FO4P |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | ethyl 3-diphenylphosphoryl-2-(4-fluorophenyl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(O)(CP(=O)(c1ccccc1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FO4P/c1-2-28-22(25)23(26,18-13-15-19(24)16-14-18)17-29(27,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,26H,2,17H2,1H3 |
| InChIKey | AAHBZKOHFWPIER-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|