C18H19O5P — CID 164684544
2-(diphenylphosphorylmethyl)-3-methoxy-2-methyl-3-oxopropanoic acid (PubChem CID 164684544) has the molecular formula C18H19O5P and a molecular weight of 346.32 g/mol. Its IUPAC name is 2-(diphenylphosphorylmethyl)-3-methoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-(diphenylphosphorylmethyl)-3-methoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 164684544 |
| Molecular Formula | C18H19O5P |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-(diphenylphosphorylmethyl)-3-methoxy-2-methyl-3-oxopropanoic acid |
| SMILES | COC(=O)C(C)(CP(=O)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H19O5P/c1-18(16(19)20,17(21)23-2)13-24(22,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H,19,20) |
| InChIKey | YDSINZLOIXZPTR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|