C10H11BrO4S — CID 114899636
2-[(5-bromothiophen-2-yl)methyl]-3-methoxy-2-methyl-3-oxopropanoic acid (PubChem CID 114899636) has the molecular formula C10H11BrO4S and a molecular weight of 307.17 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-3-methoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-3-methoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114899636 |
| Molecular Formula | C10H11BrO4S |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-3-methoxy-2-methyl-3-oxopropanoic acid |
| SMILES | COC(=O)C(C)(Cc1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C10H11BrO4S/c1-10(8(12)13,9(14)15-2)5-6-3-4-7(11)16-6/h3-4H,5H2,1-2H3,(H,12,13) |
| InChIKey | VIODSHMUHZOBRM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|