C10H13BrN2O3S — CID 18073219
2-[(5-bromothiophen-2-yl)methylcarbamoylamino]-2-methylpropanoic acid (PubChem CID 18073219) has the molecular formula C10H13BrN2O3S and a molecular weight of 321.20 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methylcarbamoylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(5-bromothiophen-2-yl)methylcarbamoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 18073219 |
| Molecular Formula | C10H13BrN2O3S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methylcarbamoylamino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)NCc1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C10H13BrN2O3S/c1-10(2,8(14)15)13-9(16)12-5-6-3-4-7(11)17-6/h3-4H,5H2,1-2H3,(H,14,15)(H2,12,13,16) |
| InChIKey | POWJLBGXBZPCBA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |