C11H16BrNO2S — CID 115221121
4-[(5-bromothiophen-2-yl)methylamino]-2,2-dimethylbutanoic acid (PubChem CID 115221121) has the molecular formula C11H16BrNO2S and a molecular weight of 306.23 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(5-bromothiophen-2-yl)methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 115221121 |
| Molecular Formula | C11H16BrNO2S |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCc1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C11H16BrNO2S/c1-11(2,10(14)15)5-6-13-7-8-3-4-9(12)16-8/h3-4,13H,5-7H2,1-2H3,(H,14,15) |
| InChIKey | RBJRIZLSFUQEKG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|