C10H15BrN2O2S — CID 122127216
4-[(5-bromo-1,3-thiazol-2-yl)methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127216) has the molecular formula C10H15BrN2O2S and a molecular weight of 307.21 g/mol. Its IUPAC name is 4-[(5-bromo-1,3-thiazol-2-yl)methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(5-bromo-1,3-thiazol-2-yl)methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127216 |
| Molecular Formula | C10H15BrN2O2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 4-[(5-bromo-1,3-thiazol-2-yl)methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNCc1ncc(Br)s1)C(=O)O |
| InChI | InChI=1S/C10H15BrN2O2S/c1-10(2,9(14)15)3-4-12-6-8-13-5-7(11)16-8/h5,12H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | GXTYUWKUMFPRPI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|