C9H14BrClN2OS — CID 91663076
N-[2-[(5-bromothiophen-2-yl)methylamino]ethyl]acetamide;hydrochloride (PubChem CID 91663076) has the molecular formula C9H14BrClN2OS and a molecular weight of 313.65 g/mol. Its IUPAC name is N-[2-[(5-bromothiophen-2-yl)methylamino]ethyl]acetamide;hydrochloride.
| Compound Name | N-[2-[(5-bromothiophen-2-yl)methylamino]ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 91663076 |
| Molecular Formula | C9H14BrClN2OS |
| Molecular Weight | 313.65 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | N-[2-[(5-bromothiophen-2-yl)methylamino]ethyl]acetamide;hydrochloride |
| SMILES | CC(=O)NCCNCc1ccc(Br)s1.Cl |
| InChI | InChI=1S/C9H13BrN2OS.ClH/c1-7(13)12-5-4-11-6-8-2-3-9(10)14-8;/h2-3,11H,4-6H2,1H3,(H,12,13);1H |
| InChIKey | NFWDFOQEHBYCDL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.65 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|