C7H10BrClN2OS — CID 119292889
2-amino-N-[(5-bromothiophen-2-yl)methyl]acetamide;hydrochloride (PubChem CID 119292889) has the molecular formula C7H10BrClN2OS and a molecular weight of 285.59 g/mol. Its IUPAC name is 2-amino-N-[(5-bromothiophen-2-yl)methyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[(5-bromothiophen-2-yl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119292889 |
| Molecular Formula | C7H10BrClN2OS |
| Molecular Weight | 285.59 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | 2-amino-N-[(5-bromothiophen-2-yl)methyl]acetamide;hydrochloride |
| SMILES | Cl.NCC(=O)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C7H9BrN2OS.ClH/c8-6-2-1-5(12-6)4-10-7(11)3-9;/h1-2H,3-4,9H2,(H,10,11);1H |
| InChIKey | XJIDQFCJCFKOEA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.59 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |