C10H14BrNO2S — CID 79210221
N-[(5-bromothiophen-2-yl)methyl]-5-hydroxypentanamide (PubChem CID 79210221) has the molecular formula C10H14BrNO2S and a molecular weight of 292.20 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-5-hydroxypentanamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-5-hydroxypentanamide |
|---|---|
| PubChem CID | 79210221 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-5-hydroxypentanamide |
| SMILES | O=C(CCCCO)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C10H14BrNO2S/c11-9-5-4-8(15-9)7-12-10(14)3-1-2-6-13/h4-5,13H,1-3,6-7H2,(H,12,14) |
| InChIKey | PXFXLOVRZRTWEG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|