C10H14BrNOS — CID 60738185
N-[(5-bromothiophen-2-yl)methyl]pentanamide (PubChem CID 60738185) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]pentanamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 60738185 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C10H14BrNOS/c1-2-3-4-10(13)12-7-8-5-6-9(11)14-8/h5-6H,2-4,7H2,1H3,(H,12,13) |
| InChIKey | DRKOLEVHQJEHFM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |