C13H14BrNOS2 — CID 32774203
N-[(5-bromothiophen-2-yl)methyl]-4-thiophen-2-ylbutanamide (PubChem CID 32774203) has the molecular formula C13H14BrNOS2 and a molecular weight of 344.30 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 32774203 |
| Molecular Formula | C13H14BrNOS2 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H14BrNOS2/c14-12-7-6-11(18-12)9-15-13(16)5-1-3-10-4-2-8-17-10/h2,4,6-8H,1,3,5,9H2,(H,15,16) |
| InChIKey | GZLPDYIPBNVDFP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |