C11H16BrNO2S — CID 112728063
N-[(5-bromothiophen-2-yl)methyl]-4-ethoxybutanamide (PubChem CID 112728063) has the molecular formula C11H16BrNO2S and a molecular weight of 306.22 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-4-ethoxybutanamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-4-ethoxybutanamide |
|---|---|
| PubChem CID | 112728063 |
| Molecular Formula | C11H16BrNO2S |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-4-ethoxybutanamide |
| SMILES | CCOCCCC(=O)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C11H16BrNO2S/c1-2-15-7-3-4-11(14)13-8-9-5-6-10(12)16-9/h5-6H,2-4,7-8H2,1H3,(H,13,14) |
| InChIKey | YAAUQEZPAYGPKA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|