C11H17BrN2OS2 — CID 115579082
1-[(5-bromothiophen-2-yl)methyl]-3-(3-ethoxypropyl)thiourea (PubChem CID 115579082) has the molecular formula C11H17BrN2OS2 and a molecular weight of 337.31 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 115579082 |
| Molecular Formula | C11H17BrN2OS2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C11H17BrN2OS2/c1-2-15-7-3-6-13-11(16)14-8-9-4-5-10(12)17-9/h4-5H,2-3,6-8H2,1H3,(H2,13,14,16) |
| InChIKey | QALQSKMLALKMCA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|