C12H20N2O2S — CID 113218414
1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]thiourea (PubChem CID 113218414) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 113218414 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]thiourea |
| SMILES | CCOCCCNC(=S)NCCc1ccco1 |
| InChI | InChI=1S/C12H20N2O2S/c1-2-15-9-4-7-13-12(17)14-8-6-11-5-3-10-16-11/h3,5,10H,2,4,6-9H2,1H3,(H2,13,14,17) |
| InChIKey | SNCLXGACDYMGBO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|