C20H32IN3O4 — CID 111663244
1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111663244) has the molecular formula C20H32IN3O4 and a molecular weight of 505.40 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111663244 |
| Molecular Formula | C20H32IN3O4 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\CC(C)(O)c1ccc(C)o1)NCCc1ccco1.I |
| InChI | InChI=1S/C20H31N3O4.HI/c1-4-25-13-6-11-21-19(22-12-10-17-7-5-14-26-17)23-15-20(3,24)18-9-8-16(2)27-18;/h5,7-9,14,24H,4,6,10-13,15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | DLOKYMIWMSBUMW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|