C18H28IN3O3 — CID 111661024
2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111661024) has the molecular formula C18H28IN3O3 and a molecular weight of 461.34 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111661024 |
| Molecular Formula | C18H28IN3O3 |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCCc1ccco1.I |
| InChI | InChI=1S/C18H27N3O3.HI/c1-5-19-17(20-9-8-15-7-6-10-23-15)21-12-18(4,22)16-11-13(2)24-14(16)3;/h6-7,10-11,22H,5,8-9,12H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | GDWAZEQJIIAKFW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|