C15H24IN3O2 — CID 111661036
2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 111661036) has the molecular formula C15H24IN3O2 and a molecular weight of 405.28 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111661036 |
| Molecular Formula | C15H24IN3O2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N/CC(C)(O)c1cc(C)oc1C)NCC.I |
| InChI | InChI=1S/C15H23N3O2.HI/c1-6-8-17-14(16-7-2)18-10-15(5,19)13-9-11(3)20-12(13)4;/h1,9,19H,7-8,10H2,2-5H3,(H2,16,17,18);1H |
| InChIKey | XISFELQTGOHRSZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|