C16H30IN3O2 — CID 111661046
1-butyl-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine;hydroiodide (PubChem CID 111661046) has the molecular formula C16H30IN3O2 and a molecular weight of 423.34 g/mol. Its IUPAC name is 1-butyl-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-butyl-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111661046 |
| Molecular Formula | C16H30IN3O2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 1-butyl-2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCCCN/C(=N/CC(C)(O)c1cc(C)oc1C)NCC.I |
| InChI | InChI=1S/C16H29N3O2.HI/c1-6-8-9-18-15(17-7-2)19-11-16(5,20)14-10-12(3)21-13(14)4;/h10,20H,6-9,11H2,1-5H3,(H2,17,18,19);1H |
| InChIKey | PKOMYALNBZXWPH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|