C18H29N5O2 — CID 111660705
2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine (PubChem CID 111660705) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine.
| Compound Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111660705 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCCCn1ccnc1 |
| InChI | InChI=1S/C18H29N5O2/c1-5-20-17(21-7-6-9-23-10-8-19-13-23)22-12-18(4,24)16-11-14(2)25-15(16)3/h8,10-11,13,24H,5-7,9,12H2,1-4H3,(H2,20,21,22) |
| InChIKey | JDRSSTYHSAKABA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|