C18H35IN4O4S — CID 111660316
2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine;hydroiodide (PubChem CID 111660316) has the molecular formula C18H35IN4O4S and a molecular weight of 530.47 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111660316 |
| Molecular Formula | C18H35IN4O4S |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCCCN(C)S(=O)(=O)CC.I |
| InChI | InChI=1S/C18H34N4O4S.HI/c1-7-19-17(20-10-9-11-22(6)27(24,25)8-2)21-13-18(5,23)16-12-14(3)26-15(16)4;/h12,23H,7-11,13H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | OYPLDBKLBMGEHR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|